| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Chlorobenzaldehyde dimethyl acetal 9& manufacturers
|
| | 4-Chlorobenzaldehyde dimethyl acetal 9& Basic information |
| | 4-Chlorobenzaldehyde dimethyl acetal 9& Chemical Properties |
| Boiling point | 114-115 °C/19 mmHg (lit.) | | density | 1.128 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.508(lit.) | | Fp | 215 °F | | storage temp. | 2-8°C | | InChI | InChI=1S/C9H11ClO2/c1-11-9(12-2)7-3-5-8(10)6-4-7/h3-6,9H,1-2H3 | | InChIKey | YRNBYTFFWMWTGG-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(C(OC)OC)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Chlorobenzaldehyde dimethyl acetal 9& Usage And Synthesis |
| Uses | 4-Chlorobenzaldehyde dimethyl acetal has been prepared from 4-chlorobenzaldehyde in the presence of cerium (lV) ammonium nitrate and characterized by 1H and 13C-NMR. | | General Description | 4-Chlorobenzaldehyde dimethyl acetal has been prepared from 4-chlorobenzaldehyde in the presence of cerium (lV) ammonium nitrate and characterized by 1H and 13C-NMR. |
| | 4-Chlorobenzaldehyde dimethyl acetal 9& Preparation Products And Raw materials |
|