| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-(Bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane CAS:3418-24-4 Purity:AldrichCPR Package:1G Remarks:PH016684-1G
|
| Company Name: |
Suzhou C1 Technology Co.,Ltd
|
| Tel: |
18606219109 |
| Email: |
ty.sales1@feixiangchem.com |
| Products Intro: |
Product Name:2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane CAS:3418-24-4 Purity:0.99 Package:根据客户要求确定
|
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310; |
| Email: |
3003867561@qq.com |
| Products Intro: |
Product Name:2-Bromomethyl-2-(4-chlorophenyl)-1,3-dioxolane CAS:3418-24-4 Purity:98% Package:5mg;10mg;20mg;50mg;100mg;200mg
|
| Company Name: |
SHAANXI?DIDEU?MEDICHEM CO.LTD
|
| Tel: |
17691182729; 17392216275 |
| Email: |
1102@dideu.com |
| Products Intro: |
Product Name:2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE CAS:3418-24-4 Purity:98% Package:25KG
|
|
| | 2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE Basic information |
| Product Name: | 2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE | | Synonyms: | 2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE;2-(BROMOMETHYL)-2-(P-CHLOROPHENYL)DIOXOLANE;BUTTPARK 147\06-68;6-(Chloromethyl)-2-(phenoxymethyl)-4-pyrimidinol;1,3-Dioxolane, 2-(bromomethyl)-2-(4-chlorophenyl)- | | CAS: | 3418-24-4 | | MF: | C10H10BrClO2 | | MW: | 277.54 | | EINECS: | | | Product Categories: | | | Mol File: | 3418-24-4.mol |  |
| | 2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE Chemical Properties |
| Boiling point | 335.0±42.0 °C(Predicted) | | density | 1.545±0.06 g/cm3(Predicted) | | form | powder | | InChI | 1S/C10H10BrClO2/c11-7-10(13-5-6-14-10)8-1-3-9(12)4-2-8/h1-4H,5-7H2 | | InChIKey | XKXPROBTEJTMQK-UHFFFAOYSA-N | | SMILES | BrCC1(C2=CC=C(Cl)C=C2)OCCO1 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids |
| | 2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE Usage And Synthesis |
| | 2-(BROMOMETHYL)-2-(4-CHLOROPHENYL)-1,3-DIOXOLANE Preparation Products And Raw materials |
|