Fmoc-alpha-methyl-L-Phe manufacturers
|
| | Fmoc-alpha-methyl-L-Phe Basic information |
| | Fmoc-alpha-methyl-L-Phe Chemical Properties |
| Melting point | 72-75°C | | Boiling point | 621.2±50.0 °C(Predicted) | | density | 1.256±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), DMF (Slightly), Methanol (Slightly) | | pka | 3.81±0.11(Predicted) | | form | Powder | | color | White to pale yellow | | Optical Rotation | -9.9°(C=0.01g/mI, MEOH, 20°C, 589nm) | | InChI | InChI=1/C25H23NO4/c1-25(23(27)28,15-17-9-3-2-4-10-17)26-24(29)30-16-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h2-14,22H,15-16H2,1H3,(H,26,29)(H,27,28)/t25-/s3 | | InChIKey | KLBKBAAOPOXFSK-TWALBRDWNA-N | | SMILES | C1(COC(=O)N[C@](C)(C(=O)O)CC2=CC=CC=C2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| | Fmoc-alpha-methyl-L-Phe Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Fmoc-alpha-methyl-L-phenylalanine is a useful reagent for the synthesis of peptidic partial agonists of human neuromedin U receptor with enhanced serum stability. |
| | Fmoc-alpha-methyl-L-Phe Preparation Products And Raw materials |
|