2,5-Anhydro-D-mannitol manufacturers
|
| | 2,5-Anhydro-D-mannitol Basic information |
| Product Name: | 2,5-Anhydro-D-mannitol | | Synonyms: | 2,5-ANHYDRO-D-MANNITOL;2,5-anhydromannitol;(2R,3S,4S,5R)-2,5-Bis(hydroxymethyl)oxolane-3,4-diol;2,5-Anhydro-D-mannitol, Min. 98%;(2R,3S,4S,5R)-2,5-Bis(hydroxymethyl)tetrahydrofuran-3,4-diol;2,5-Bis(hydroxymethyl)oxolane-3,4-diol;D-Mannitol, 2,5-anhydro-;(2R)-3β,4α-Dihydroxytetrahydrofuran-2α,5β-bismethanol | | CAS: | 41107-82-8 | | MF: | C6H12O5 | | MW: | 164.16 | | EINECS: | 255-221-7 | | Product Categories: | 13C & 2H Sugars;Carbohydrates & Derivatives;Inhibitors;Sugars | | Mol File: | 41107-82-8.mol |  |
| | 2,5-Anhydro-D-mannitol Chemical Properties |
| Melting point | 101-103 °C(lit.) | | alpha | 56.7 º (c=1, H2O 19 ºC) | | Boiling point | 211.61°C (rough estimate) | | density | 1.1738 (rough estimate) | | refractive index | 1.4230 (estimate) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 13.26±0.70(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C6H12O5/c7-1-3-5(9)6(10)4(2-8)11-3/h3-10H,1-2H2/t3-,4-,5-,6-/m1/s1 | | InChIKey | MCHWWJLLPNDHGL-KVTDHHQDSA-N | | SMILES | [C@H]1(O)[C@H](O)[C@@H](CO)O[C@@H]1CO |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2940000080 |
| | 2,5-Anhydro-D-mannitol Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A carbohydrate metabolism regulator that has been shown to inhibit gluconeogenesis from lactate plus pyruvate and from substrates that enter the gluconeogenic pathway as triose phosphate |
| | 2,5-Anhydro-D-mannitol Preparation Products And Raw materials |
| Raw materials | L-Mannitol, 2,5-anhydro-, tetraacetate (9CI)-->D-Mannitol, 2,5-anhydro-1,3,4-tris-O-(phenylmethyl)--->(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol hydrochloride-->2,5-Anhydro-D-mannitol Tetraacetate-->2,5-ANHYDRO-D-MANNOSE | | Preparation Products | D-Iditol, 2,5-anhydro--->2,5-Anhydro-D-glucitol |
|