4-VINYL-BENZALDEHYDE manufacturers
- 4-VINYL-BENZALDEHYDE
-
- $0.00 / 1kg
-
2025-04-04
- CAS:1791-26-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | 4-VINYL-BENZALDEHYDE Basic information |
| Product Name: | 4-VINYL-BENZALDEHYDE | | Synonyms: | 4-VINYL-BENZALDEHYDE;4-Formylstyrene;4-Ethenylbenzaldehyde;p-Formylstyrene;Benzaldehyde,4-ethenyl;p-vinylbenzaldehyde;4-Vinylbenzaldehyde，97%;TIANFU 1791-26-0 4-VINYL-BENZALDEHYDE | | CAS: | 1791-26-0 | | MF: | C9H8O | | MW: | 132.16 | | EINECS: | | | Product Categories: | Chloromethy styrene | | Mol File: | 1791-26-0.mol |  |
| | 4-VINYL-BENZALDEHYDE Chemical Properties |
| Melting point | 129-131 °C | | Boiling point | 92-93 °C(Press: 14 Torr) | | density | 1.036 g/cm3(Temp: 25 °C) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H8O/c1-2-8-3-5-9(7-10)6-4-8/h2-7H,1H2 | | InChIKey | QBFNGLBSVFKILI-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(C=C)C=C1 |
| | 4-VINYL-BENZALDEHYDE Usage And Synthesis |
| Uses | 4-Vinylbenzaldehyde is a mushroom tyrosinase inhibitor. |
| | 4-VINYL-BENZALDEHYDE Preparation Products And Raw materials |
|