| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3',5'-Dibromo-4'-hydroxyacetophenone Basic information |
| | 3',5'-Dibromo-4'-hydroxyacetophenone Chemical Properties |
| Melting point | 182-187 °C(lit.) | | Boiling point | 337.7±42.0 °C(Predicted) | | density | 1.936±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | solubility | very faint turbidity in hot Methanol | | pka | 5.11±0.23(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C8H6Br2O2/c1-4(11)5-2-6(9)8(12)7(10)3-5/h2-3,12H,1H3 | | InChIKey | ZNWPTJSBHHIXLJ-UHFFFAOYSA-N | | SMILES | CC(=O)c1cc(Br)c(O)c(Br)c1 | | CAS DataBase Reference | 2887-72-1(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2914790090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| | 3',5'-Dibromo-4'-hydroxyacetophenone Usage And Synthesis |
| Uses | 3′,5′-Dibromo-4′-hydroxyacetophenone (3,5-dibromo-4-hydroxyacetophenone) can be obtained from 4-hydroxyacetophenone, via bromination by N-bromosuccinimide in the presence of LiClO4-SiO2. | | Preparation | Preparation by bromination of 4-hydroxyacetophenone in dilute acetic acid (94%),(80%), (75%) (62%). | | General Description | 3′,5′-Dibromo-4′-hydroxyacetophenone (3,5-dibromo-4-hydroxyacetophenone) can be obtained from 4-hydroxyacetophenone, via bromination by N-bromosuccinimide in the presence of LiClO4-SiO2. |
| | 3',5'-Dibromo-4'-hydroxyacetophenone Preparation Products And Raw materials |
|