| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Fenthion sulfoxide
CAS:3761-41-9
Purity:100 μg/ML in DichloroMethane Package:1ML
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:O,O-diMethyl O-(3-Methyl-4-(Methylsulfinyl)phenyl) phosphorothioate
CAS:3761-41-9
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
- FENTHION-SULFOXIDE
-
- $1.00 / 1KG
-
2024-07-14
- CAS:3761-41-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20t
|
| | FENTHION-SULFOXIDE Basic information |
| | FENTHION-SULFOXIDE Chemical Properties |
| Melting point | 58～60℃ | | Boiling point | 110 °C(Press: 0.01 Torr) | | density | 1.34±0.1 g/cm3(Predicted) | | Fp | 2 °C | | storage temp. | APPROX 4°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | BRN | 2136026 | | InChI | 1S/C10H15O4PS2/c1-8-7-9(5-6-10(8)17(4)11)14-15(16,12-2)13-3/h5-7H,1-4H3 | | InChIKey | DLAPIMGBBDILHJ-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)Oc1ccc(c(C)c1)S(C)=O | | EPA Substance Registry System | Phosphorothioic acid, O,O-dimethyl O-[3-methyl-4-(methylsulfinyl)phenyl] ester (3761-41-9) |
| Hazard Codes | F,Xn,N,T | | Risk Statements | 11-20/21/22-36-50/53-25 | | Safety Statements | 16-26-36-60-61-45 | | RIDADR | 2783 | | WGK Germany | 3 | | RTECS | TF9400000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | FENTHION-SULFOXIDE Usage And Synthesis |
| Uses | Fenthion Sulfoxide is the sulfoxide anlogue and metabolite of the organothiophosphate insecticide Fenthion (F278000). |
| | FENTHION-SULFOXIDE Preparation Products And Raw materials |
|