| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1H,1H-Perfluorononylamine Basic information |
| Product Name: | 1H,1H-Perfluorononylamine | | Synonyms: | 1H,1H-HEPTADECAFLUORONONYLAMINE;1H,1H-Perfluorononylamine 95%;Perfluorononylamine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononylamine technical, >=90% (T);1-Nonanamine, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononan-1-amine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluoro-1-nonanamine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononylamine | | CAS: | 355-47-5 | | MF: | C9H4F17N | | MW: | 449.11 | | EINECS: | | | Product Categories: | | | Mol File: | 355-47-5.mol |  |
| | 1H,1H-Perfluorononylamine Chemical Properties |
| Boiling point | 165 °C | | density | 1.640±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 6.07±0.30(Predicted) | | form | solid | | InChI | 1S/C9H4F17N/c10-2(11,1-27)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h1,27H2 | | InChIKey | IHVFAVFXCUPMEN-UHFFFAOYSA-N | | SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 355-47-5(CAS DataBase Reference) | | EPA Substance Registry System | 1H,1H-Perfluorononylamine (355-47-5) |
| Hazard Codes | C,Xi | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3259 8/PG 2 | | WGK Germany | 3 | | F | 10-34 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | 1H,1H-Perfluorononylamine Usage And Synthesis |
| | 1H,1H-Perfluorononylamine Preparation Products And Raw materials |
|