| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Amidinopyridinium chloride Basic information |
| Product Name: | 3-Amidinopyridinium chloride | | Synonyms: | 3-pyridinecarboximidamide,monohydrochloride;3-Amidinopyridinium hydrochloride,97%;pyridine-3-carboximidamideHCl;3-Amidinopyridinium chloride ,97%;3-Carbamimidoylpyridinium chloride;3-pyridinecarboxaMidine hydrochloride/nicotiniMidaMide hydrochloride;Pyridine-3-carboximidamide hydrochloride, 95%+;Pyridine-3-carboxamidine hydrochloride0.5 hydrate , Tech. | | CAS: | 7356-60-7 | | MF: | C6H8ClN3 | | MW: | 157.6 | | EINECS: | 615-990-5 | | Product Categories: | Heterocycles;Pyridines | | Mol File: | 7356-60-7.mol |  |
| | 3-Amidinopyridinium chloride Chemical Properties |
| Melting point | 188 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Almost white | | Sensitive | Hygroscopic | | InChI | InChI=1S/C6H7N3.ClH.H2O/c7-6(8)5-2-1-3-9-4-5;;/h1-4H,(H3,7,8);1H;1H2 | | InChIKey | AZMSXJKFYNDTCL-UHFFFAOYSA-N | | SMILES | C(N)(=N)C1=CC=CN=C1.Cl.O | | CAS DataBase Reference | 7356-60-7(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 3-Amidinopyridinium chloride Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Nicotinimidamide Hydrochloride is a useful synthetic compound. | | Synthesis | General Method B: The synthesis of pyridine-3-carboxamidine hydrochloride from 3-cyanopyridine was carried out as follows:
1. 3-Cyanopyridine (20 g, 0.2 mol) was dissolved in methanol (200 mL).
2. Powdered sodium methanolate (1.1 g, 20 mmol) was added in a single addition.
3. The reaction mixture was stirred at room temperature overnight.
4. After addition of ammonium chloride (16.5 g, 0.31 mol), the mixture was heated to reflux for 4 hours and then cooled.
5. The solvent was removed under vacuum.
6. Anhydrous ethanol (300 mL) was added and the mixture was heated to reflux and maintained for 15 minutes.
7. After filtering out the solids, the mixture was cooled to room temperature and allowed to stand overnight.
8. The inorganic salt was filtered out again and the reaction mixture was concentrated to about a certain volume and filtered to give pyridine-3-carboxamidine hydrochloride (22.4 g, 74% yield).
Product characterization data.
1H NMR (500 MHz, DMSO-d6) δ 9.5 (bs, 4H), 9.02 (dd, 1H, J = 2.5 Hz, J = 0.9 Hz), 8.86 (dd, 1H, J = 4.9 Hz, J = 1.6 Hz), 8.27 (ddd, 1H, J = 8.0 Hz, J = 2.5 Hz, J = 1.6 Hz), 7.64 (ddd, 1H, J = 8.0 Hz, J = 4.9 Hz, J = 0.9 Hz).
13C NMR (125 MHz, DMSO-d6) δ 164.4, 154.2, 148.9, 136.5, 124.7, 123.9.
HRMS: calculated C6H7N3, 121.0640; measured, 121.0644. | | References | [1] Patent: WO2014/128213, 2014, A1. Location in patent: Page/Page column 29 [2] Bioorganic and Medicinal Chemistry Letters, 2016, vol. 26, # 15, p. 3487 - 3490 [3] Journal of Medicinal Chemistry, 1990, vol. 33, # 4, p. 1230 - 1241 [4] Patent: US5294612, 1994, A [5] Bioorganic and Medicinal Chemistry Letters, 2010, vol. 20, # 1, p. 299 - 301 |
| | 3-Amidinopyridinium chloride Preparation Products And Raw materials |
|