|
|
| | Ethyl N-Boc-piperidine-4-carboxylate Basic information |
| | Ethyl N-Boc-piperidine-4-carboxylate Chemical Properties |
| Boiling point | 120-135 °C/0.5 mmHg | | density | 1.046 g/mL at 25 °C | | refractive index | n20/D 1.458 | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Ethyl Acetate | | pka | -2.23±0.40(Predicted) | | form | Liquid | | color | Clear colorless to pale yellow | | InChI | InChI=1S/C13H23NO4/c1-5-17-11(15)10-6-8-14(9-7-10)12(16)18-13(2,3)4/h10H,5-9H2,1-4H3 | | InChIKey | MYHJCTUTPIKNAT-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(C(OCC)=O)CC1 | | CAS DataBase Reference | 142851-03-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | Ethyl N-Boc-piperidine-4-carboxylate Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | Ethyl N-Boc-piperidine-4-carboxylate is used as a reagent to synthesize 3-amino-1-(5-indanyloxy)-2-propanol derivatives as sodium channel blockers to treat stroke patients. Ethyl N-Boc-piperidine-4-carboxylate is also used as a reagent to prepare inhibitors of tumour necrosis factor alpha-converting enzyme. | | Uses | Substrate used in a palladium-catalyzed α-arylation of esters with heterocyclic bromides and chlorides leading to, for example, 4-pyridylpiperidinyl esters. | | Synthesis | The general procedure for the synthesis of ethyl N-Boc-4-piperidinecarboxylate from di-tert-butyl dicarbonate was as follows: ethyl isopiperidinate (5.00 g, 0.032 mol) and triethylamine (4.9 mL, 0.035 mol) were dissolved in dichloromethane (25 mL) at 0 °C, and the dichloromethane of di-tert-butyl dicarbonate (7.2 g, 0.033 mol) was slowly added ( 25mL) solution. The reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, it was washed three times with potassium bisulfate solution and then once with brine. The organic layer was dried with anhydrous sodium sulfate, filtered and concentrated in vacuum to afford the target product ethyl N-Boc-4-piperidinecarboxylate (8.23 g, 100% yield) as a colorless oil. The structure of the product was confirmed by 1H NMR (C6D6,500MHz) δ 3.88 (q, J=7.5Hz, 2H), 2.52 (m, 1H), 1.60-1.48 (m, 8H), 1.42 (s, 9H), 0.92 (t, 3H) and mass spectra (280.44 (M+Na)+). | | References | [1] Patent: US2004/204397, 2004, A1
[2] Patent: US2003/144302, 2003, A1
[3] Patent: US2002/55631, 2002, A1
[4] Patent: US2002/86887, 2002, A1
[5] Patent: US5716965, 1998, A |
| | Ethyl N-Boc-piperidine-4-carboxylate Preparation Products And Raw materials |
|