|
|
| | 5-Amino-4-methylpyrimidine Basic information |
| | 5-Amino-4-methylpyrimidine Chemical Properties |
| Melting point | 151-151.5 °C | | Boiling point | 246.8±20.0 °C(Predicted) | | density | 1.155±0.06 g/cm3(Predicted) | | refractive index | n20D 1.58 (Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.21±0.16(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C5H7N3/c1-4-5(6)2-7-3-8-4/h2-3H,6H2,1H3 | | InChIKey | DQNDDUOCVSWTOW-UHFFFAOYSA-N | | SMILES | C1=NC=C(N)C(C)=N1 | | CAS DataBase Reference | 3438-61-7(CAS DataBase Reference) |
| | 5-Amino-4-methylpyrimidine Usage And Synthesis |
| Uses | 5-Amino-4-methylpyrimidine is a pharmaceutical intermediate compound. Its structural features include a methyl group and an amino group attached to the 4th and 5th positions, respectively, on the pyrimidine ring. This substance can be used in the preparation of anticancer inhibitory compounds. | | Synthesis | When 5-amino-2,4- dichloro-6-methylpyrimidine was hydrogenated over 10% palladium-on-charcoal in the presence of excess magnesium oxide a 31 % yield of 5-amino-4-methylpyrimidine was obtained[1].
| | References | [1] C. G. Overberger, W. J. E., Irving C. Kogon. (1954). Derivatives of 5-Amino-4-methylpyrimidine. Journal of the American Chemical Society, 76 7, 1953–1954. https://doi.org/10.1021/ja01636a069 |
| | 5-Amino-4-methylpyrimidine Preparation Products And Raw materials |
|