|
|
| | N-(4-Methoxyphenyl)-4-methylbenzenamine Basic information |
| Product Name: | N-(4-Methoxyphenyl)-4-methylbenzenamine | | Synonyms: | (4-METHOXY-PHENYL)-P-TOLYL-AMINE;N-(4-Methoxyphenyl)-4-methylbenzenamine;4-Methoxy-4'-methyldiphenylamine;4-methoxy-N-4-tolylaniline;(4-Methoxy-phenyl)-p-tolylanMine;N-(4-Methoxyphenyl)-p-tolylamine;4-Methoxy-N-(p-tolyl)aniline;N-(4-Methoxyphenyl)-4-methylbenzemine | | CAS: | 39253-43-5 | | MF: | C14H15NO | | MW: | 213.27 | | EINECS: | 677-590-7 | | Product Categories: | | | Mol File: | 39253-43-5.mol |  |
| | N-(4-Methoxyphenyl)-4-methylbenzenamine Chemical Properties |
| Melting point | 82.0 to 86.0 °C | | Boiling point | 354.9±25.0 °C(Predicted) | | density | 1.089±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.92±0.40(Predicted) | | form | powder to crystal | | color | White to Light gray to Light yellow | | InChI | InChI=1S/C14H15NO/c1-11-3-5-12(6-4-11)15-13-7-9-14(16-2)10-8-13/h3-10,15H,1-2H3 | | InChIKey | KIDXWDVZFZMXGM-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=C(C)C=C2)=CC=C(OC)C=C1 |
| | N-(4-Methoxyphenyl)-4-methylbenzenamine Usage And Synthesis |
| Uses | N-(4-Methoxyphenyl)-4-methylbenzenamine is primarily
used for producing materials in electronics such as OLEDs and other small molecule semiconductors. |
| | N-(4-Methoxyphenyl)-4-methylbenzenamine Preparation Products And Raw materials |
|