|
|
| | N-Phenyl-N-(4-piperidinyl)propanamide admixture with HCl salt Basic information |
| Product Name: | N-Phenyl-N-(4-piperidinyl)propanamide admixture with HCl salt | | Synonyms: | AKOS BBS-00006338;N-PHENYL-N-PIPERIDIN-4-YLPROPANAMIDE;N-PHENYL-N-PIPERIDIN-4-YL-PROPIONAMIDE;N-Phenyl-N-(4-piperidinyl)propanamide admixture with HCl salt;NORFENTANYL OXALATE;N-Piperidin-4-yl-N-phenylpropionamide;NSC 89293;n-phenyl-n-(4-piperidinyl)propanamideadmixturewithhydrochloridesalt | | CAS: | 1609-66-1 | | MF: | C14H20N2O | | MW: | 232.32 | | EINECS: | 216-543-3 | | Product Categories: | | | Mol File: | 1609-66-1.mol |  |
| | N-Phenyl-N-(4-piperidinyl)propanamide admixture with HCl salt Chemical Properties |
| Melting point | 92℃ | | Boiling point | 359.8±35.0 °C(Predicted) | | density | 1.075±0.06 g/cm3(Predicted) | | vapor pressure | 0.001-0.002Pa at 20-25℃ | | solubility | DMF: 30 mg/ml; DMSO: 20 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml | | pka | 9.81±0.10(Predicted) | | form | Powder | | color | Almost white to light yellow | | Water Solubility | Insoluble in water. | | BRN | 480031 | | Major Application | pharmaceutical | | InChI | 1S/C14H20N2O.H2O/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13;/h3-7,13,15H,2,8-11H2,1H3;1H2 | | InChIKey | PMCBDBWCQQBSRJ-UHFFFAOYSA-N | | SMILES | CCC(N(C1=CC=CC=C1)C2CCNCC2)=O.O | | LogP | -1.5-1.3 at 20℃ and pH7.1-12.7 | | CAS DataBase Reference | 1609-66-1 | | EPA Substance Registry System | Propanamide, N-phenyl-N-4-piperidinyl- (1609-66-1) |
| Hazard Codes | C,Xn | | Risk Statements | 34-22-36/38 | | Safety Statements | 45-36/37/39-26 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| Provider | Language |
|
ACROS
| English |
| | N-Phenyl-N-(4-piperidinyl)propanamide admixture with HCl salt Usage And Synthesis |
| Description | Norfentanyl (Item No. ISO60195) is a certified reference material that is classified as an opioid. It is a thermal degradant and major urinary metabolite of the opioid analgesic, fentanyl (Item Nos. ISO60197 | 14719). This product is intended for forensic and research applications. | | Chemical Properties | light yellow powder | | Uses | Norfentanyl is a major urinary metabolite of a narcotic analgesic fentanyl. | | Definition | ChEBI: A monocarboxylic acid amide resulting from the formal condensation of the aryl amino group of 4-(N'-phenyl)piperidin-4-amine with propanoic acid. A major metabolite of fentanyl. | | References | [1] KATHERINE M JOSEPH. First Detection of Xylazine in Texas Wastewater and Its Association with Fentanyl Use.[J]. medRxiv: the preprint server for health sciences, 2024. DOI: 10.1101/2024.11.19.24317580 |
| | N-Phenyl-N-(4-piperidinyl)propanamide admixture with HCl salt Preparation Products And Raw materials |
|