- Pectolinarigenin
-
- $0.00 / 20mg
-
2023-02-24
- CAS:520-12-7
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Pectolinarigenin Basic information |
| | Pectolinarigenin Chemical Properties |
| Melting point | 220-223° | | Boiling point | 565.5±50.0 °C(Predicted) | | density | 1.402±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | pka | 6.49±0.40(Predicted) | | color | Light yellow to yellow | | Major Application | food and beverages | | InChI | 1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3 | | InChIKey | GPQLHGCIAUEJQK-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](cc1c3ccc(cc3)OC)=O)c(c(c(c2)O)OC)O | | LogP | 2.640 (est) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids |
| | Pectolinarigenin Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from airplane grass. | | Uses | Scutellarein-6,4''-dimethyl ether (CAS# 520-12-7) is a flavonoid isolated from South African weed Chromolaena odorata (Asteraceae) having pharmacological activity against uropathogens. | | Definition | ChEBI: A dimethoxyflavone that is the 6,4'-dimethyl ether derivative of scutellarein. | | IC 50 | COX-2; 5-LOX |
| | Pectolinarigenin Preparation Products And Raw materials |
|