|
|
| | 4-(dimethylamino)phenol Basic information |
| Product Name: | 4-(dimethylamino)phenol | | Synonyms: | 4-(dimethylamino)phenol;4-N,N-DIMETHYLAMINOPHENOL;N,N-Dimethyl-4-aminophenol;N,N-Dimethyl-p-hydroxyaniline;p-(Dimethylamino)phenol;p-Hydroxy-N,N-dimethylaniline;Phenol,4-(diMethylaMino)-;Phenol, p-(dimethylamino)- | | CAS: | 619-60-3 | | MF: | C8H11NO | | MW: | 137.18 | | EINECS: | 210-604-8 | | Product Categories: | | | Mol File: | 619-60-3.mol |  |
| | 4-(dimethylamino)phenol Chemical Properties |
| Melting point | 138-141℃ | | Boiling point | 260℃ | | density | 1.089 | | refractive index | 1.5560 (estimate) | | Fp | 136℃ | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | pka | 10.11±0.13(Predicted) | | form | solid | | color | Off-white | | InChI | InChI=1S/C8H11NO/c1-9(2)7-3-5-8(10)6-4-7/h3-6,10H,1-2H3 | | InChIKey | JVVRCYWZTJLJSG-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N(C)C)C=C1 |
| RIDADR | UN2928 | | RTECS | US9230000 | | HazardClass | 6.1, 8 | | HS Code | 2921490090 |
| | 4-(dimethylamino)phenol Usage And Synthesis |
| Uses | 4-(Dimethylamino)phenol increases the extracellular lactate dehydrogenase (LDH) without markedly affecting gluconeogenesis. 4-(Dimethylamino)phenol cannot decreases the ATP content until the membrane becomes permeable to LDH[1]. | | Definition | ChEBI: 4-dimethylaminophenol is a tertiary amino compound and a dialkylarylamine. | | References | [1] Szinicz LL, et al. Effects of 4-dimethylaminophenol in rat kidneys, isolated rat kidney tubules and hepatocytes. Xenobiotica. 1980;10(7-8):611-620. DOI:10.3109/00498258009033795 |
| | 4-(dimethylamino)phenol Preparation Products And Raw materials |
|