- 2-methylaminophenol
-
- $3.00 / 25KG
-
2026-04-17
- CAS:611-24-5
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2-METHYLAMINOPHENOL
-
- $1.00 / 1kg
-
2019-07-06
- CAS:611-24-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | 2-METHYLAMINOPHENOL Basic information |
| Product Name: | 2-METHYLAMINOPHENOL | | Synonyms: | 2-METHYLAMINOPHENOL;o-(methylamino)phenol;2-Methylaminophenol,97%;2-(Methylamino)phenol,N-Methyl-2-aminophenol, N-Methyl-2-hydroxyaniline;N-Methyl-2-hydroxyaniline;N-Methyl-o-hydroxyaniline;NSC 245030;2-Hydroxy-N-methylaniline | | CAS: | 611-24-5 | | MF: | C7H9NO | | MW: | 123.15 | | EINECS: | 210-263-5 | | Product Categories: | | | Mol File: | 611-24-5.mol |  |
| | 2-METHYLAMINOPHENOL Chemical Properties |
| Melting point | 85-88 °C | | Boiling point | 229.26°C (rough estimate) | | density | 1.0877 (rough estimate) | | refractive index | 1.5730 (589.3 nm 33℃) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | crystals | | pka | 10.62±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 970951 | | InChI | InChI=1S/C7H9NO/c1-8-6-4-2-3-5-7(6)9/h2-5,8-9H,1H3 | | InChIKey | JHKKTXXMAQLGJB-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC=C1NC |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 29222900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ACROS
| English |
| | 2-METHYLAMINOPHENOL Usage And Synthesis |
| Chemical Properties | brown very fine crystalline powder |
| | 2-METHYLAMINOPHENOL Preparation Products And Raw materials |
|