| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
|
| | 1,2-Bis((2R,5R)-2,5-dimethylphospholano& Basic information |
| Product Name: | 1,2-Bis((2R,5R)-2,5-dimethylphospholano& | | Synonyms: | 1,2-Bis[(2R,5R)-2,5-dimethylphospholano]benzene monooxide;R,R-Me-BozPhos, (2R,5R)-1-{2-[(2R,5R)-2,5-Dimethylphospholan-1-yl]phenyl}-2,5-dimethylphospholane 1-oxide;[1-(2R,5R)-2,5-dimethylphospholanyl]-[2-(2R,5R)-2,5-dimethylphospholanyl-1-oxide]benzene, min. 97%;(2R,5R)-1-(2-[(2R,5R)-2,5-DiMethylphospholan-1-yl]phenyl)-2,5-diMethylphospholane 1-oxide, 97+%;R,R-Me-BozPhos;1,2-Bis[(2R,5R)-2,5-dimethylphospholano]benzene monooxide kanata purity;[1-(2R,5R)-2,5-DIMETHYLPHOSPHOLANYL]-[2-(2R,5R)-2,5-DIMETHYLPHOSPHOLANYL-1-OXIDE]BENZENE,MIN.97%;[1-(2R,5R)-2,5-dimethylphospholanyl]-[2-(2R,5R)-2,5-dimethylphospholanyl-1-oxide]benzene | | CAS: | 638132-66-8 | | MF: | C18H28OP2 | | MW: | 322.36 | | EINECS: | | | Product Categories: | | | Mol File: | 638132-66-8.mol |  |
| | 1,2-Bis((2R,5R)-2,5-dimethylphospholano& Chemical Properties |
| Melting point | 116-122 °C | | Boiling point | 484.0±28.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | white | | Optical Rotation | [α]22/D -171°, c = 1 in chloroform | | Sensitive | Air Sensitive | | InChI | 1S/C18H28OP2/c1-13-9-10-14(2)20(13)17-7-5-6-8-18(17)21(19)15(3)11-12-16(21)4/h5-8,13-16H,9-12H2,1-4H3/t13-,14-,15-,16-/m1/s1 | | InChIKey | ORZVYNTUPREFTI-KLHDSHLOSA-N | | SMILES | C[C@@H]1CC[C@@H](C)P1(C2=CC=CC=C2P3[C@H](C)CC[C@H]3C)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,2-Bis((2R,5R)-2,5-dimethylphospholano& Usage And Synthesis |
| Uses | DuPhos and BPE Ligands: Highly Efficient Privileged Ligands | | General Description | 1,2-Bis[(2R,5R)-2,5-dimethylphospholano]benzene monooxide is a chiral ligand whose copper complexes are used extensively in many organic reactions such as addition to imines, nitroalkenes, and reduction of β,β-disubstituted vinyl sulfones. |
| | 1,2-Bis((2R,5R)-2,5-dimethylphospholano& Preparation Products And Raw materials |
|