|
|
| | (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE Basic information | | Reactions |
| Product Name: | (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE | | Synonyms: | (2R,2'R,5R,5'R)-2,2'-5,5'-TETRAETHYL-1,1'-(O-PHENYLENE)DIPHOSPHOLANE;(-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE;(R,R)-ETHYL-DUPHOS;(R,R)-ET-DUPHOS;(-)-1,2-Bis[(2R,5R)-2,5-diethylphospholano]benzene, Kanata purity;(-)-1,2-Bis((2R,5R)-2,5-diethylphospholano)benzene(r,r)-et-duphos;(-)-1,2-Bis((2R,5R)-2,5-diethylphospholano)benzene,98+%(R,R)-Et-DUPHOS;(R,R)-Ethyl-DUPHOS, (2R,2μR,5R,5μR)-2,2μ-5,5μ-Tetraethyl-1,1μ-(o-phenylene)diphospholane | | CAS: | 136705-64-1 | | MF: | C22H36P2 | | MW: | 362.47 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 136705-64-1.mol |  |
| | (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE Chemical Properties |
| alpha | D25 -265° (c = 1 in hexane) | | Boiling point | bp0.045 138-145° | | density | 1.01 g/mL at 25 °C | | refractive index | n 20/D 1.6 | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Colorless to light yellow Liquid | | Sensitive | Air Sensitive | | Merck | 13,3499 | | BRN | 4814174 | | InChI | 1S/C22H36P2/c1-5-17-13-14-18(6-2)23(17)21-11-9-10-12-22(21)24-19(7-3)15-16-20(24)8-4/h9-12,17-20H,5-8,13-16H2,1-4H3/t17-,18-,19-,20-/m1/s1 | | InChIKey | GVVCHDNSTMEUCS-UAFMIMERSA-N | | SMILES | CC[C@@H]1CC[C@@H](CC)P1c2ccccc2P3[C@H](CC)CC[C@H]3CC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 1-10 | | HS Code | 29310099 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 |
| | (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE Usage And Synthesis |
| | (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE Preparation Products And Raw materials |
|