| Company Name: |
Sigma-Aldrich Gold |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene manufacturers
|
| | (+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene Basic information | | Reaction |
| Product Name: | (+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene | | Synonyms: | (R,R)-I-PR-DUPHOS;(+)-1,2-BIS((2R,5R)-2,5-DI-I-PROPYLPHOSPHOLANO)BENZENE;(+)-1,2-BIS[(2R,5R)-2,5-DIISOPROPYLPHOSPHOLANO]BENZENE;BisRRdiipropylphospholanobenzene;(+)-1,2-Bis[(2R, 5R)-2,5-diisopropylphospholano]benzene, Kanata purity;(+)-1,2-Bis((2R,5R)-2,5-di-i-propylphospholano)benzene,98+%(R,R)-i-Pr-DUPHOS;1,2-Bis[(2R,5R)-2,5-diisopropyl-1-phospholanyl]benzene, 97+%;(+)-1,2-Bis((2R,5R)-2,5-di-i-propylphospholano)benzene (R,R)-i-Pr-DUPHOS | | CAS: | 136705-65-2 | | MF: | C26H44P2 | | MW: | 418.58 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 136705-65-2.mol | ![(+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene Structure](CAS/GIF/136705-65-2.gif) |
| | (+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene Chemical Properties |
| Melting point | 40°C | | alpha | +85° (c 1, hexane) | | Boiling point | 502.0±20.0 °C(Predicted) | | refractive index | n20/D 1.5701 | | Fp | >110°(230°F) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white | | Optical Rotation | [α]20/D +103°, c = 1 in chloroform | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C26H44P2/c1-17(2)21-13-14-22(18(3)4)27(21)25-11-9-10-12-26(25)28-23(19(5)6)15-16-24(28)20(7)8/h9-12,17-24H,13-16H2,1-8H3/t21-,22-,23-,24-/m1/s1 | | InChIKey | RBVGOQHQBUPSGX-MOUTVQLLSA-N | | SMILES | C1(P2[C@@H](C(C)C)CC[C@@H]2C(C)C)=CC=CC=C1P1[C@@H](C(C)C)CC[C@@H]1C(C)C |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene Usage And Synthesis |
| Reaction |
- The DUPHOS family of catalysts is highly efficient for the asymmetric hydrogenation of various substituted acetamidoacrylates and enol acetates yielding products of high enantiomeric excesses. Efficient ligand for the asymmetric hydrogenation of tetrasubstituted enamides.
- Forms superior catalysts for asymmetric reductive aminations.
- Catalyst used for the asymmetric hydrogenation of enol phosphonates.
- A novel enantioselective synthesis of β-amino alcohols and 1,2-diamines.
| | Uses | It is used as ligands like DuPhos and BPE ligands and are highly efficient privileged ligands. | | Uses | DuPhos and BPE Ligands: Highly Efficient Privileged Ligands | | General Description | Optical rotation devation ± 13 |
| | (+)-1,2-Bis[(2R,5R)-2,5-diisopropylphospholano]benzene Preparation Products And Raw materials |
|