|
|
| | (+)-1,2-BIS[(2S,5S)-2,5-DIETHYLPHOSPHOLANO]BENZENE Basic information | | Reaction |
| Product Name: | (+)-1,2-BIS[(2S,5S)-2,5-DIETHYLPHOSPHOLANO]BENZENE | | Synonyms: | (S,S)-ETHYL-DUPHOS;(S,S)-ET-DUPHOS;1,2-Bis((2S,5S)-2,5-diethylphospholan-1-yl)benzene;(+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene, Kanata purity;(+)-1,2-Bis((2S,5S)-2,5-diethylphospholano)benzene,98+%(S,S)-Et-DUPHOS;(S,S)-Ethyl-DUPHOS, (2S,2μS,5S,5μS)-2,2μ,5,5μ-Tetraethyl-1,1μ-(o-phenylene)diphospholane;(2S,2'S,5S,5'S)-2,2',5,5'-TETRAETHYL-1,1'-(1,2-PHENYLENE)DIPHOSPHOLANE;(2S,2'S,5S,5'S)-2,2',5,5'-TETRAETHYL-1,1'-(O-PHENYLENE)DIPHOSPHOLANE | | CAS: | 136779-28-7 | | MF: | C22H36P2 | | MW: | 362.47 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 136779-28-7.mol | ![(+)-1,2-BIS[(2S,5S)-2,5-DIETHYLPHOSPHOLANO]BENZENE Structure](CAS/GIF/136779-28-7.gif) |
| | (+)-1,2-BIS[(2S,5S)-2,5-DIETHYLPHOSPHOLANO]BENZENE Chemical Properties |
| alpha | +265° (c 1, hexane) | | Boiling point | 468.5±15.0 °C(Predicted) | | density | 1.010 g/mL at 25 °C | | refractive index | n20/D 1.581 | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Colorless to light yellow Viscous Liquid | | Optical Rotation | 146.34°(C=1.00g/100mL, hexane, 20°C, 589nm) | | Sensitive | Air Sensitive | | BRN | 4814174 | | InChI | 1S/C22H36P2/c1-5-17-13-14-18(6-2)23(17)21-11-9-10-12-22(21)24-19(7-3)15-16-20(24)8-4/h9-12,17-20H,5-8,13-16H2,1-4H3/t17-,18-,19-,20-/m0/s1 | | InChIKey | GVVCHDNSTMEUCS-MUGJNUQGSA-N | | SMILES | CC[C@H]1CC[C@H](CC)P1c2ccccc2P3[C@@H](CC)CC[C@@H]3CC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 1-10 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (+)-1,2-BIS[(2S,5S)-2,5-DIETHYLPHOSPHOLANO]BENZENE Usage And Synthesis |
| | (+)-1,2-BIS[(2S,5S)-2,5-DIETHYLPHOSPHOLANO]BENZENE Preparation Products And Raw materials |
|