|
|
| Product Name: | TUTIN | | Synonyms: | (7R,8R)-1aβ,1b,5,6,6a,7aβ-Hexahydro-1bα,6β-dihydroxy-6aα-methyl-8-(1-methylethenyl)spiro[2α,5α-methano-7H-oxireno[3,4]cyclopent[1,2-d]oxepine-7,2'-oxiran]-3(2H)-one;(1As-(1aalpha,1bbeta,2beta,5beta,6alpha,6abeta,7beta,7aalpha,8S*))-hexahydro-1B,6-dihydroxy-6A-methyl-8-(1-methylethenyl)spiro(2,5-methano-7H-oxireno(3,4)cyclopent(1,2-D)oxepin-7,2'-oxiran)-3(2alpha H)-one;Spiro(2,5-methano-7H-oxireno(3,4)cyclopent(1,2-D)oxepin-7,2'-oxiran)-3(2ah)-one, 1A-beta,1B,5A,6,6A,7A-beta-hexahydro-1B-alpha,6-beta-dihydroxy-8A-isopropenyl-6A-alpha-methyl-;Toot poison;Tutine;TUTIN;Spiro[2,5-methano-7H-oxireno[3,4]cyclopent[1,2-d]oxepin-7,2'-oxiran]-3(2H)-one, hexahydro-1b,6-dihydroxy-6a-methyl-8-(1-methylethenyl)-, (1aS,1bR,2S,2'R,5R,6S,6aR,7aR,8R)-;Tutin solution | | CAS: | 2571-22-4 | | MF: | C15H18O6 | | MW: | 294.3 | | EINECS: | | | Product Categories: | | | Mol File: | 2571-22-4.mol |  |
| | TUTIN Chemical Properties |
| Melting point | 209-212°; mp 204-205° (Wakamatsu) | | alpha | D20 +9.25° (alc); D17 +13.9° (c = 0.75, methanol) | | Boiling point | 356.07°C (rough estimate) | | density | 1.1975 (rough estimate) | | refractive index | 1.4359 (estimate) | | storage temp. | -20°C | | pka | 12.83±0.70(Predicted) | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C15H18O6/c1-5(2)6-7-12(17)20-8(6)9(16)13(3)14(4-19-14)10-11(21-10)15(7,13)18/h6-11,16,18H,1,4H2,2-3H3/t6-,7+,8+,9+,10+,11-,13-,14+,15-/m0/s1 | | InChIKey | CCAZWUJBLXKBAY-ULZPOIKGSA-N | | SMILES | O1[C@@]2([C@@H]3O[C@@H]3[C@@]4([C@]2([C@@H]([C@@H]5OC(=O)[C@H]4[C@@H]5C(=C)C)O)C)O)C1 | | LogP | 1.380 (est) |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 | | Toxicity | LD50 i.p. in female mice: 3.0 mg/kg (Jarboe) |
| | TUTIN Usage And Synthesis |
| Uses | Coriaria Lactone can be used in biological study for effects of tutin and its derivatives on GAD and GABA-T in Pseudelatia separata tested as novel active ingredients for pest control. It is also utilized in agricultural use for anti-feedant activities and effects of tutin and its derivatives on mythimna separata and its physiological parameters. | | Definition | ChEBI: Tutin is a gamma-lactone. |
| | TUTIN Preparation Products And Raw materials |
|