DL-Benzylsuccinic acid manufacturers
|
| | DL-Benzylsuccinic acid Basic information |
| | DL-Benzylsuccinic acid Chemical Properties |
| Melting point | 160-161°C | | storage temp. | -20°C Freezer | | pka | pK1: 4.11;pK2: 5.65 (20°C) | | InChI | InChI=1S/C11H12O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15) | | InChIKey | GTOFKXZQQDSVFH-UHFFFAOYSA-N | | SMILES | C(C(=O)O)(CC(=O)O)CC1C=CC=CC=1 | | CAS DataBase Reference | 36092-42-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 |
| | DL-Benzylsuccinic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An effective inhibitor of carboxypeptidase A | | Definition | ChEBI: 2-benzylsuccinic acid is a dicarboxylic acid consisting of succinic acid carrying a 2-benzyl substituent. It has a role as a bacterial xenobiotic metabolite. It is functionally related to a succinic acid. It is a conjugate acid of a 2-benzylsuccinate(2-) and a (R)-2-benzylsuccinate. |
| | DL-Benzylsuccinic acid Preparation Products And Raw materials |
|