A-METHYL-L-TRYPTOPHAN manufacturers
- H-a-Me-DL-Trp-OH
-
-
2022-02-19
- CAS:153-91-3
- Min. Order: 1KG
- Purity: 99.1%
- Supply Ability: 100 tons
|
| | A-METHYL-L-TRYPTOPHAN Basic information |
| | A-METHYL-L-TRYPTOPHAN Chemical Properties |
| Melting point | 234 °C(Solv: ethanol, 60% (64-17-5)) | | Boiling point | 444.0±35.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 2.34±0.10(Predicted) | | form | crystalline | | color | light yellow | | InChI | 1S/C12H14N2O2/c1-12(13,11(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,14H,6,13H2,1H3,(H,15,16) | | InChIKey | ZTTWHZHBPDYSQB-UHFFFAOYSA-N | | SMILES | CC(N)(Cc1c[nH]c2ccccc12)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | A-METHYL-L-TRYPTOPHAN Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | α-methyl-DL-tryptophan is used as a blocker of ATBo, an amino acid transporter whose expression is upregulated in cancer. It is also a substrate or non-transported inhibitor of the amino acid transporter PAT2 (slc36a2). | | Biochem/physiol Actions | α-methyl-DL-tryptophan is a blocker of ATBo, an amino acid transporter whose expression is upregulated in cancer. | | in vivo | α-Methyl-DL-tryptophan (α-MT) (2 mg/mL; administered in drinking water; continuously administered; throughout the experimental period) inhibits tumor growth in BALB/c nude mice inoculated with ZR-75-1 cells[1].
α-Methyl-DL-tryptophan (1 mg/mL; administered in drinking water; continuously administered; for 1 week) reduces body weight in wild-type mice on a high-fat diet[2].
| Animal Model: | BALB/c nude mice (female) inoculated with ZR-75-1 cells[1] | | Dosage: | 2 mg/mL | | Administration: | Administered in drinking water | | Result: | Reduced the growth of ZR-75-1 cells. Tumor size was significantly smaller than that in the control group. |
| Animal Model: | Wild-type C57BL/6 male mice fed a high-fat diet[2] | | Dosage: | 1 mg/mL | | Administration: | Administered in drinking water, continuously for 1weeks | | Result: | Led to a decrease in body weight. |
|
| | A-METHYL-L-TRYPTOPHAN Preparation Products And Raw materials |
|