|
|
| | 4-CYANO-4-(4-FLUOROPHENYL)CYCLOHEXANONE Basic information | | Uses |
| Product Name: | 4-CYANO-4-(4-FLUOROPHENYL)CYCLOHEXANONE | | Synonyms: | 4-CYANO-4-(4-FLUOROPHENYL)CYCLOHEXANONE;1-(4-FLUOROPHENYL)-4-OXOCYCLOHEXANE-CARBONITRILE;4-Cyano-4-(4-flurophenyl)cyclohexanone;1-(4-Fluorophenyl)-4-oxocyclohexane-1-carbonitrile;Einecs 260-111-7;4-Cyano-4-(4-fluorophenyl)cyclohexanone ,98%;Levocabastine EP Impurity H;Cyclohexanecarbonitrile, 1-(4-fluorophenyl)-4-oxo- | | CAS: | 56326-98-8 | | MF: | C13H12FNO | | MW: | 217.24 | | EINECS: | 260-111-7 | | Product Categories: | | | Mol File: | 56326-98-8.mol |  |
| | 4-CYANO-4-(4-FLUOROPHENYL)CYCLOHEXANONE Chemical Properties |
| Melting point | 91-94°C | | Boiling point | 373.6±42.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H12FNO/c14-11-3-1-10(2-4-11)13(9-15)7-5-12(16)6-8-13/h1-4H,5-8H2 | | InChIKey | FNWWTNNFZGBMEM-UHFFFAOYSA-N | | SMILES | FC1=CC=C(C2(C#N)CCC(CC2)=O)C=C1 |
| RIDADR | UN3439 | | WGK Germany | WGK 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-CYANO-4-(4-FLUOROPHENYL)CYCLOHEXANONE Usage And Synthesis |
| Uses | 4-Cyano-4-(4-fluorophenyl)cyclohexanone is used as a reagent in the synthesis of novel 4,4-disubstituted cyclohexylbenzamide derivatives as potent 11β-HSD1 inhibitors. | | Uses | 4-Cyano-4-(4-fluorophenyl)cyclohexanone is used as a reagent in the synthesis of novel 4,4-disubstituted cyclohexylbenzamide derivatives as potent 11β-HSD1 inhibitors. |
| | 4-CYANO-4-(4-FLUOROPHENYL)CYCLOHEXANONE Preparation Products And Raw materials |
|