|
|
| | Anthranilic acid, N-Boc-4-chloro Basic information |
| | Anthranilic acid, N-Boc-4-chloro Chemical Properties |
| Melting point | 148° (dec) | | Boiling point | 352.430±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.339±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.475±0.36(predicted) | | InChI | 1S/C12H14ClNO4/c1-12(2,3)18-11(17)14-9-6-7(13)4-5-8(9)10(15)16/h4-6H,1-3H3,(H,14,17)(H,15,16) | | InChIKey | PJFHAVFRBIRVQD-UHFFFAOYSA-N | | SMILES | Clc1cc(c(cc1)C(=O)O)NC(=O)OC(C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Anthranilic acid, N-Boc-4-chloro Usage And Synthesis |
| | Anthranilic acid, N-Boc-4-chloro Preparation Products And Raw materials |
|