- 1,4-DIMETHYLPYRAZOLE
-
- $1.00
-
2019-07-06
- CAS:1072-68-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 1,4-DIMETHYLPYRAZOLE Basic information | | Uses |
| Product Name: | 1,4-DIMETHYLPYRAZOLE | | Synonyms: | 1,4-DIMETHYLPYRAZOLE;1,4-Dimethyl-1H-pyrazol;1H-Pyrazole, -1,4-dimethyl-;1,4-two methyl pyrazole;1,4-DIMETHYL-1H-PYRAZOLE;Pyrazole, 1,4-dimethyl- | | CAS: | 1072-68-0 | | MF: | C5H8N2 | | MW: | 96.13 | | EINECS: | 600-813-6 | | Product Categories: | | | Mol File: | 1072-68-0.mol |  |
| | 1,4-DIMETHYLPYRAZOLE Chemical Properties |
| Boiling point | 148-150 °C(Press: 20 Torr) | | density | 0.9608 g/cm3(Temp: 18 °C) | | vapor pressure | 3.47-21.3hPa at 20-50℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.80±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H8N2/c1-5-3-6-7(2)4-5/h3-4H,1-2H3 | | InChIKey | SZQCPPRPWDXLMM-UHFFFAOYSA-N | | SMILES | N1(C)C=C(C)C=N1 | | Surface tension | 68.8mN/m at 1g/L and 20℃ |
| | 1,4-DIMETHYLPYRAZOLE Usage And Synthesis |
| Uses | An important intermediate for the herbicide chlorpyrifos, and a pharmaceutical intermediate. |
| | 1,4-DIMETHYLPYRAZOLE Preparation Products And Raw materials |
|