- Aloin B
-
-
2026-06-30
- CAS:28371-16-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
- Aloin B
-
- $52.00
-
2026-05-11
- CAS:28371-16-6
- Purity: 99.77%
- Supply Ability: 10g
- Aloin B
-
-
2023-02-24
- CAS:28371-16-6
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 100 g
|
| | Aloin B Basic information |
| Product Name: | Aloin B | | Synonyms: | 9(10H)-Anthracenone,10-β-D-glucopyranosyl-1,8-;dihydroxy-3-(hydroxymethyl)-,(R)-;Isobarbaloin;(10R)-10-β-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone;9(10H)-Anthracenone,10-b-D-glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-,(10R)-;Aloin B, >99%;(R)-10-(β-D-Glucopyranosyl)-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone;(R)-10-(β-D-Glucopyranosyl)-1,8-dihydroxy-3-(hydroxymethyl)anthracen-9(10H)-one | | CAS: | 28371-16-6 | | MF: | C21H22O9 | | MW: | 418.4 | | EINECS: | | | Product Categories: | | | Mol File: | 28371-16-6.mol |  |
| | Aloin B Chemical Properties |
| Melting point | 147~148℃ | | Boiling point | 752.6±60.0 °C(Predicted) | | density | 1.647±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 0.25 mg/ml; PBS (pH 7.2): 0.5 mg/ml | | form | A crystalline solid | | pka | 7.12±0.40(Predicted) | | color | Light yellow to yellow | | Major Application | (pharmaceutical small molecule) | | InChIKey | AFHJQYHRLPMKHU-GQMFJIQQNA-N | | SMILES | O[C@@H]1[C@H]([C@H](O)[C@@H](CO)O[C@@]1([H])[C@]1([H])C2=CC=CC(O)=C2C(=O)C2C(=CC(CO)=CC1=2)O)O |&1:1,2,3,5,9,11,r| |
| WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Aloin B Usage And Synthesis |
| Chemical Properties | Yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the dicotyledonous plant Liliaceae Aloe vera L. | | Uses | Aloin B is an aloe exudate and a phytochemical constituent. It is one isomer of Aloin, the other being Aloin A (A575415) | | Definition | ChEBI: A C-glycosyl compound that is beta-D-glucopyranose in which the anomeric hydroxy group is replaced by a 4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl moiety (the 9R d
astereoisomer). |
| | Aloin B Preparation Products And Raw materials |
|