| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (+)-2,3-O-Isopropylidene-L-threitol Basic information |
| Product Name: | (+)-2,3-O-Isopropylidene-L-threitol | | Synonyms: | L(+)-2,2-DIMETHYL-1,3-DIOXOLANE-4,5-DIMETHANOL;2,3-O-ISOPROPYLIDENE-L-THREITOL;(4S-TRANS)-2,2-DIMETHYL-1,3-DIOXOLANE-4,5-DIMETHANOL;(4S,5S)-2,2-DIMETHYL-1,3-DIOXOLANE-4,5-DIMETHANOL;(4S,5S)-(+)-4,5-BIS(HYDROXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(4S,5S)-4,5-BIS(HYDROXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(4S,5S)-4,5-DIHYDROXYMETHYL-2,2-DIMETHYLDIOXOLANE;(S,S)-(+)-2,3-O-ISOPROPYLIDENE-L-THREITOL | | CAS: | 50622-09-8 | | MF: | C7H14O4 | | MW: | 162.18 | | EINECS: | 256-658-6 | | Product Categories: | Sugars;Synthetic Organic Chemistry;Chiral Compound;Biochemistry;Chiral Building Blocks;Dioxanes & Dioxolanes;Dioxolanes;Glycidyl Compounds, etc. (Chiral);O-Substituted Sugars;Sugar Alcohols | | Mol File: | 50622-09-8.mol |  |
| | (+)-2,3-O-Isopropylidene-L-threitol Chemical Properties |
| Melting point | 46-50 °C | | Boiling point | 92-94 °C0.1 mm Hg(lit.) | | alpha | 3.1 º (c=5, EtOH 24 ºC) | | density | 1.0585 (rough estimate) | | refractive index | 3.9 ° (C=5, Acetone) | | Fp | >110°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DCM, Ether | | pka | 13.90±0.10(Predicted) | | form | Oil | | color | Clear Colourless | | Optical Rotation | [α]20/D +3.0±0.5°, c = 5% in ethanol | | Water Solubility | soluble | | Sensitive | Hygroscopic | | BRN | 1280797 | | InChI | 1S/C7H14O4/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6,8-9H,3-4H2,1-2H3/t5-,6-/m0/s1 | | InChIKey | INVRLGIKFANLFP-WDSKDSINSA-N | | SMILES | CC1(C)O[C@@H](CO)[C@H](CO)O1 | | CAS DataBase Reference | 50622-09-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29329970 | | Storage Class | 11 - Combustible Solids |
| | (+)-2,3-O-Isopropylidene-L-threitol Usage And Synthesis |
| Chemical Properties | WHITE TRANSPARENT ADHERING NEEDLE LIKE CRYSTALS | | Uses | (+)-2,3-O-Isopropylidene-L-threitol is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuff. |
| | (+)-2,3-O-Isopropylidene-L-threitol Preparation Products And Raw materials |
|