| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Dioxopromethazine
-
- $1.00
-
2026-10-10
- CAS:13754-56-8
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 10000000 KG
|
| | Dioxopromethazine HCl Basic information |
| Product Name: | Dioxopromethazine HCl | | Synonyms: | 9,9-Dioxopromethazine;Dioxoprome;10-[2-(Dimethylamino)propyl]-10H-phenothiazine 5,5-dioxide;Dioxypromethazine;N,N,α-Trimethyl-10H-phenothiazine-10-ethanamine 5,5-dioxide;Prothanon;[2-(5,5-Dioxo-5H-5laMbda*6*-phenothiazin-10-yl)-1-Methyl-ethyl]-diMethyl-aMine hydrochloride;Dioxoprothazine | | CAS: | 13754-56-8 | | MF: | C17H20N2O2S | | MW: | 316.42 | | EINECS: | 1308068-626-2 | | Product Categories: | Antiallergic agents;API | | Mol File: | 13754-56-8.mol |  |
| | Dioxopromethazine HCl Chemical Properties |
| Melting point | 127-129℃ | | Boiling point | 478.5±34.0 °C(Predicted) | | density | 1.224 | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 8.88±0.50(Predicted) | | color | Light Beige | | InChI | InChI=1S/C17H20N2O2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)22(20,21)17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 | | InChIKey | FDXKCOBAFGSMDJ-UHFFFAOYSA-N | | SMILES | N1(CC(C)N(C)C)C2C=CC=CC=2S(=O)(=O)C2C=CC=CC1=2 |
| | Dioxopromethazine HCl Usage And Synthesis |
| Uses | Promethazine Sulfone, is a metabolite of Promethazine (P757000), which is a drug from antihistamine family. It has strong sedative effects and in some countries used for the treatment of insomnia. It has also antiemetic and anticholinergic properties. |
| | Dioxopromethazine HCl Preparation Products And Raw materials |
|