| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Dibenzosuberyl chloride Basic information |
| Product Name: | Dibenzosuberyl chloride | | Synonyms: | d)cycloheptene,10,11-dihydro-5-chloro-5h-dibenzo(;5-CHLORO-10,11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTENE;5-CHLORODIBENZOSUBERANE;5-Chlorodibenzosuberane~5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene;5-CHLOROBENZOSUBERANE;10,11-Dihydro-5-chloro-5H-dibenzo[a,d]cycloheptene;5-Chloro-2,3:6,7-dibenzosuberane;5H-Dibenzo[a,d]cycloheptene, 5-chloro-10,11-dihydro- | | CAS: | 1210-33-9 | | MF: | C15H13Cl | | MW: | 228.72 | | EINECS: | 214-910-2 | | Product Categories: | Alkyl;Building Blocks;Chemical Synthesis;Halogenated Hydrocarbons;Organic Building Blocks;Protection & Derivatization Reagents (for Synthesis);Synthetic Organic Chemistry | | Mol File: | 1210-33-9.mol |  |
| | Dibenzosuberyl chloride Chemical Properties |
| Melting point | 106-107 °C (lit.) | | Boiling point | 321.7±31.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | Sensitive | Moisture Sensitive | | BRN | 612280 | | Stability: | Light Sensitive | | InChI | InChI=1S/C15H13Cl/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15H,9-10H2 | | InChIKey | QPERNSDCEUTOTE-UHFFFAOYSA-N | | SMILES | C12=CC=CC=C1C(Cl)C1=CC=CC=C1CC2 | | CAS DataBase Reference | 1210-33-9(CAS DataBase Reference) |
| Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | WGK Germany | 3 | | RTECS | HO8302000 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29039930 | | Storage Class | 11 - Combustible Solids |
| | Dibenzosuberyl chloride Usage And Synthesis |
| Uses | Reagent for introduction of the 5-dibenzosuberyl moiety as a modulator for anticancer drugs.1 | | Uses | Dibenzosuberyl Chloride is used in the synthesis of atypical tricyclic antidepressant as well as dibenzosuberyl-substituted tropines as ligands for acetylcholine-binding protein. Dibenzosuberyl Chloride is also used in the preparation of amino protecting group for solid phase peptide synthesis. |
| | Dibenzosuberyl chloride Preparation Products And Raw materials |
|