|
|
| | 2,3,6-Trifluorophenylboronic acid Basic information |
| Product Name: | 2,3,6-Trifluorophenylboronic acid | | Synonyms: | RARECHEM AH PB 0123;RARECHEM AH PB 0119;2,3,6-Trifluorobenzeneboronic acid 98%;2,3,6-Trifluorobenzeneboronic acid;2,3,6-Trifluorophenylboronic acid;2,3,6-Trifluorophenylboronic acid;Boronic acid, B-(2,3,6-trifluorophenyl)-;Atogepant Impurity 6 | | CAS: | 247564-71-2 | | MF: | C6H4BF3O2 | | MW: | 175.9 | | EINECS: | | | Product Categories: | Boronic Acids;Boronic Acids and Derivatives;blocks;BoronicAcids;Boric acid;Boronic Acid;Aryl;Organoborons | | Mol File: | 247564-71-2.mol |  |
| | 2,3,6-Trifluorophenylboronic acid Chemical Properties |
| Melting point | 127-132 °C (lit.) | | Boiling point | 266.0±50.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 7.09±0.58(Predicted) | | color | Off White | | InChI | InChI=1S/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H | | InChIKey | IWPDDRPLEKURGG-UHFFFAOYSA-N | | SMILES | B(C1=C(F)C=CC(F)=C1F)(O)O | | CAS DataBase Reference | 247564-71-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2931900090 | | Storage Class | 13 - Non Combustible Solids |
| | 2,3,6-Trifluorophenylboronic acid Usage And Synthesis |
| Uses | Reactant for:
- Synthesis of C-6 hydroxy tricyclic sulfone as a γ-secretase inhibitor via Suzuki coupling reaction
- Palladium catalyzed Suzuki-Miyaura coupling reactions
| | General Description | Contains varying amounts of anhydride. |
| | 2,3,6-Trifluorophenylboronic acid Preparation Products And Raw materials |
|