| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Isopropoxy-2,3,5,6-tetrafluorobenzeneboronic acid Basic information |
| Product Name: | 4-Isopropoxy-2,3,5,6-tetrafluorobenzeneboronic acid | | Synonyms: | [2,3,5,6-TETRAFLUORO-4-(1-METHYLETHOXY)PHENYL]BORONIC ACID;(2,3,5,6-Tetrafluoro-4-isopropoxyphenyl)-boronic acid;(2,3,5,6-tetrafluoro-4-propan-2-yloxyphenyl)boronic acid;Boronic acid, B-[2,3,5,6-tetrafluoro-4-(1-methylethoxy)phenyl]- | | CAS: | 871126-28-2 | | MF: | C9H9BF4O3 | | MW: | 251.97 | | EINECS: | | | Product Categories: | blocks;BoronicAcids;Aryl;Boronic Acids;Boronic Acids and Derivatives | | Mol File: | 871126-28-2.mol |  |
| | 4-Isopropoxy-2,3,5,6-tetrafluorobenzeneboronic acid Chemical Properties |
| Melting point | 138-142 | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C9H9BF4O3/c1-3(2)17-9-7(13)5(11)4(10(15)16)6(12)8(9)14/h3,15-16H,1-2H3 | | InChIKey | YOXGBYWSEKQTAW-UHFFFAOYSA-N | | SMILES | CC(C)Oc1c(F)c(F)c(B(O)O)c(F)c1F |
| Hazard Codes | C | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Isopropoxy-2,3,5,6-tetrafluorobenzeneboronic acid Usage And Synthesis |
| | 4-Isopropoxy-2,3,5,6-tetrafluorobenzeneboronic acid Preparation Products And Raw materials |
|