- Pyridat
-
- $1.00 / 1KG
-
2020-01-01
- CAS:55512-33-9
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | Pyridat Basic information |
| | Pyridat Chemical Properties |
| Melting point | 27° | | Boiling point | bp0.1 220° | | density | d20 1.555 | | refractive index | nD20 1.568 | | Fp | 100 °C | | storage temp. | 2-8°C | | pka | -0.84±0.10(Predicted) | | Merck | 13,8058 | | BRN | 759528 | | Henry's Law Constant | 3.0×102 mol/(m3Pa) at 25℃, Barcelo and Hennion (1997) | | Major Application | agriculture
environmental | | InChI | 1S/C19H23ClN2O2S/c1-2-3-4-5-6-10-13-25-19(23)24-16-14-17(20)21-22-18(16)15-11-8-7-9-12-15/h7-9,11-12,14H,2-6,10,13H2,1H3 | | InChIKey | JTZCTMAVMHRNTR-UHFFFAOYSA-N | | SMILES | CCCCCCCCSC(=O)Oc1cc(Cl)nnc1-c2ccccc2 | | LogP | 6.840 (est) | | CAS DataBase Reference | 55512-33-9(CAS DataBase Reference) | | NIST Chemistry Reference | Carbonothioic acid, o-(6-chloro-3-phenyl-4-pyridazinyl) s-octyl ester(55512-33-9) | | EPA Substance Registry System | Pyridate (55512-33-9) |
| Hazard Codes | Xi,N | | Risk Statements | 38-43-50/53 | | Safety Statements | 24-37-60-61 | | RIDADR | UN 3077 | | WGK Germany | 2 | | RTECS | FG3880000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Irrit. 2
Skin Sens. 1 | | Toxicity | LD50 in male rats, female rats, mice (mg/kg): 1970, 2400, >10,000 orally; in rabbits (mg/kg): >3450 dermally; LC50 (96 hr) in carp, trout: >100, 81 mg/l (Chéroux, Moncorge) |
| | Pyridat Usage And Synthesis |
| Uses | Herbicide. | | Uses | Pyridat, which is a herbicide used in agriculture. Pyridat has been used to control annual broadleaved weeds in sweet corn, cauliflower, broccoli and leek. | | Definition | ChEBI: Pyridate is a member of pyridazines. | | Hazard | Moderately toxic by ingestion and skin contact. | | Trade name | CL-11344®; LENTAGRAN®; PIRATE®; ST-9551®; TOUGH® |
| | Pyridat Preparation Products And Raw materials |
|