| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-Bromo-4-chloro-3-indoxyl-beta-D-fucopyranoside Basic information |
| | 5-Bromo-4-chloro-3-indoxyl-beta-D-fucopyranoside Chemical Properties |
| Melting point | 213-217 °C | | Boiling point | 611℃ | | density | 1.796 | | Fp | 323℃ | | storage temp. | Sealed in dry,2-8°C | | solubility | DMF: 20mg/mL, clear, colorless to faintly yellow | | pka | 12.87±0.70(Predicted) | | form | powder | | InChI | 1S/C14H15BrClNO5/c1-5-11(18)12(19)13(20)14(21-5)22-8-4-17-7-3-2-6(15)10(16)9(7)8/h2-5,11-14,17-20H,1H3/t5-,11+,12+,13-,14+/m1/s1 | | InChIKey | ZMYJTGDNFZJYFN-MFWXUWBHSA-N | | SMILES | C[C@H]1O[C@@H](Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@H](O)[C@@H](O)[C@H]1O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 5-Bromo-4-chloro-3-indoxyl-beta-D-fucopyranoside Usage And Synthesis |
| Chemical Properties | white to slightly off-white powder | | Uses | 5-Bromo-4-chloro-3-indolyl β-D-fucopyranoside is a substrate of β-Galactosidase[1]. | | References | [1] Smith WS, et al. Applying neutral drift to the directed molecular evolution of a β-glucuronidase into a β-galactosidase: Two different evolutionary pathways lead to the same variant. BMC Res Notes. 2011 May 6;4:138. DOI:10.1186/1756-0500-4-138 |
| | 5-Bromo-4-chloro-3-indoxyl-beta-D-fucopyranoside Preparation Products And Raw materials |
|