|
|
| | 1,3,6,8-Tetraphenylpyrene Basic information |
| Product Name: | 1,3,6,8-Tetraphenylpyrene | | Synonyms: | Pyrene,1,3,6,8-tetraphenyl-;1,3,6,8-Tetraphenylpyrene Solution in Toluene;1,3,6,8-Tetraphenylpyrene - [T94322];1,3,6,8-Tetraphenylpyrene | | CAS: | 13638-82-9 | | MF: | C40H26 | | MW: | 506.63 | | EINECS: | | | Product Categories: | | | Mol File: | 13638-82-9.mol |  |
| | 1,3,6,8-Tetraphenylpyrene Chemical Properties |
| Melting point | 299 °C | | Boiling point | 659.2±50.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | Light yellow to Yellow to Green | | λmax | 478nm(CH2Cl2)(lit.) | | InChI | InChI=1S/C40H26/c1-5-13-27(14-6-1)35-25-36(28-15-7-2-8-16-28)32-23-24-34-38(30-19-11-4-12-20-30)26-37(29-17-9-3-10-18-29)33-22-21-31(35)39(32)40(33)34/h1-26H | | InChIKey | SIJHJHYRYHIWFW-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=C2C3=C4C(C=C2)=C(C2=CC=CC=C2)C=C(C2=CC=CC=C2)C4=CC=C3C(C2=CC=CC=C2)=C1 |
| | 1,3,6,8-Tetraphenylpyrene Usage And Synthesis |
| | 1,3,6,8-Tetraphenylpyrene Preparation Products And Raw materials |
|