| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 12-Deoxyphorbol 13-phenylacetate 20-acetate Basic information |
| Product Name: | 12-Deoxyphorbol 13-phenylacetate 20-acetate | | Synonyms: | 12-deoxyphorbolphenylacetate-20-acetate;3-acetate9a-phenylacetate;12-Deoxyphorbol 13-phenylacate 20-acetate;(1aR)-3-(Acetyloxymethyl)-1,1aα,1bβ,4,4a,7aα,7b,8,9,9a-decahydro-4aβ,7bα-dihydroxy-1,1,6,8α-tetramethyl-9aα-[(phenylacetyl)oxy]-5H-cyclopropa[3,4]benz[1,2-e]azulen-5-one;12-DPPAA;5H-Cyclopropa(3,4)benz(1,2-E)azulen-5-one, 1,1A-alpha,1B-beta,4,4A,7A-alpha,7B,8,9,9A-decahydro-4A-beta,7B-alpha,9A-alpha-trihydroxy-3-(hydroxymethyl)-1,1,6,8-alpha-tetramethyl-, 3-acetate 9A-phenylacetate;Benzeneacetic acid ,(1ar,1bs,4ar,7as,7br,8R,9as)-3-((acetyloxy)methyl)-1,1A,1B,4,4A,5,7A,7B,8,9-decahydro-4A,7B-dihydroxy-1,1,6,8-tetramethyl-5-oxo-9ah-cyclopropa(3,4)benz(1,2-E)azulen-9A-yl ester;12-Deoxyphorbol 13-phenylacetate 20-acetate | | CAS: | 54662-30-5 | | MF: | C30H36O7 | | MW: | 508.6 | | EINECS: | | | Product Categories: | | | Mol File: | 54662-30-5.mol |  |
| | 12-Deoxyphorbol 13-phenylacetate 20-acetate Chemical Properties |
| Boiling point | 556.46°C (rough estimate) | | density | 1.0979 (rough estimate) | | refractive index | 1.6810 (estimate) | | storage temp. | -20°C | | form | oil | | color | colorless to light yellow | | InChIKey | MEDVHSNRBPAIPU-XMOZQXTISA-N | | SMILES | CC(C1=O)=C[C@]2([H])[C@]1(O)CC(COC(C)=O)=C[C@]3([H])[C@]2(O)[C@H](C)C[C@]4(OC(CC5=CC=CC=C5)=O)[C@H]3C4(C)C |
| Hazard Codes | T+ | | Risk Statements | 26/27/28-36/37/38 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation
Acute Tox. 2 Dermal
Acute Tox. 2 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 12-Deoxyphorbol 13-phenylacetate 20-acetate Usage And Synthesis |
| Uses | dPPA/phorbol ester 12-deoxyphorbol 13-phenylacetate 20-acetate (DOPPA) may be used as a potent activator of PKC-β:
- to tre at transfected HT-22 cells to promote phosphorylation of p66Shc
- to tre at HT-22 and B12 cells to study its effects on cell viability
- to tre at neurons and measure primary cortical neurons using the 2,5-diphenyl-2H-tetrazolium bromide (MTT) assay
| | Biological Activity | dPPA is a phorbol ester th at selectively activates the β isotype of PKC. It is approximately 100-fold more potent for PKC-β than the α, γ or δ isotypes. PKC family members each have specific functions, but PKC-β and δ appear to share similar expression profiles, and both are involved in regulating apoptosis and B cell activation, thus dPPA is a useful tool in determining PKCβ specific signaling events. |
| | 12-Deoxyphorbol 13-phenylacetate 20-acetate Preparation Products And Raw materials |
|