|
|
| | 2-MERCAPTO-L-HISTIDINE Basic information |
| | 2-MERCAPTO-L-HISTIDINE Chemical Properties |
| Melting point | 320-325°C | | Boiling point | 376.3±52.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Aqueous Acid (Slightly) | | form | Solid | | pka | pK1:1.84(＋1);pK2:8.47(0);pK3:11.4(SH) (25°C) | | color | Off-White | | Cosmetics Ingredients Functions | CHELATING
ANTIOXIDANT
BLEACHING | | InChI | 1S/C6H9N3O2S/c7-4(5(10)11)1-3-2-8-6(12)9-3/h2,4H,1,7H2,(H,10,11)(H2,8,9,12)/t4-/m0/s1 | | InChIKey | FVNKWWBXNSNIAR-BYPYZUCNSA-N | | SMILES | N[C@@H](Cc1c[nH]c(S)n1)C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-MERCAPTO-L-HISTIDINE Usage And Synthesis |
| Chemical Properties | Colourless Crystals | | Uses | An intermediate in the formation of L-egothioneine, a natural amino acid ubiquitously present in cells and tissues of most plants and mammalian species. In humans, L-ergothioneine is found in red blood cells, liver, kidney, brain, seminal fluid, and cataract-free lenses at concentrations ranging from 100 uM to 2 mM. L-ergothioneine is exclusively biosynthesized in fungi and mycobacteria. Hence, humans assimilate it through dietary intake.L-ergothioneine has been proven to act as an antioxidant in vivo and to afford protection from g and UV radiation as well as from singlet oxygen in vivo. Recently, it has been shown that L-ergothioneine protects isolated perfused heart against the deleterious effect of post-ischemic reperfusion.The intermediate, 2-mercaptohistine has been used for the |
| | 2-MERCAPTO-L-HISTIDINE Preparation Products And Raw materials |
|