- 2,6-Dimethylbenzyl chloride
-
- $6.00 / 1KG
-
2025-09-25
- CAS:5402-60-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,6-Dimethylbenzyl chloride Basic information |
| Product Name: | 2,6-Dimethylbenzyl chloride | | Synonyms: | 1-CHLOROMETHYL-2,6-DIMETHYLBENZENE;2-CHLOROMETHYL-1,3-DIMETHYL-BENZENE;2,6-DIMETHYLBENZYL CHLORIDE;[(2,6-diMethylphenyl)Methyl]chloranuide;2-(Chloromethyl)-1,3-dimethylbenzene, 2-(Chloromethyl)-m-xylene;D**2,6-Dimethylbenzyl chloride;2,6-DimethylbenzylChloride>;Benzene, 2-(chloromethyl)-1,3-dimethyl- | | CAS: | 5402-60-8 | | MF: | C9H11Cl | | MW: | 154.64 | | EINECS: | | | Product Categories: | Benzene derivatives | | Mol File: | 5402-60-8.mol |  |
| | 2,6-Dimethylbenzyl chloride Chemical Properties |
| Melting point | 33-35°C | | Boiling point | 70°C 5mm | | density | 1.033±0.06 g/cm3(Predicted) | | Fp | 33 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | InChI | InChI=1S/C9H11Cl/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,6H2,1-2H3 | | InChIKey | HPVRFWQMBYLJRL-UHFFFAOYSA-N | | SMILES | C1(C)=CC=CC(C)=C1CCl | | CAS DataBase Reference | 5402-60-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 3261 | | HazardClass | IRRITANT, LACHRYMATOR | | HS Code | 2916399090 |
| | 2,6-Dimethylbenzyl chloride Usage And Synthesis |
| Uses | 2,6-Dimethylbenzyl chloride (2,6-DMBC) can be used for spectroscopic studies. 2,6-DMBC as a precursor, with the addition of a large amount of the inert carrier gas He, can be used to generate jet-cooled 2,6-dimethylbenzyl radicals and used in their vibrational spectroscopic studies[1]. 2,6-DMBC can also be used in chemical manufacturing and as a reagent for reactions. The main chemical activity of 2,6-DMBC involves an electrophilic aromatic substitution reaction, where the chlorine atom replaces the hydrogen atom on the aromatic ring, a process that is usually accelerated by a This process is usually accelerated by a catalyst such as copper(II) chloride. | | References | [1] SANG KUK LEE* Sang K L; Byoung Uk Ahn. Vibronic Spectrum of the Jet-Cooled 2,6-Dimethylbenzyl Radical in a Corona Excitation[J]. The Journal of Physical Chemistry A, 2003. DOI:10.1021/jp0350215. |
| | 2,6-Dimethylbenzyl chloride Preparation Products And Raw materials |
|