|
|
| | L-N-Cbz-3-N-Boc-Amino-alanine Basic information |
| | L-N-Cbz-3-N-Boc-Amino-alanine Chemical Properties |
| Melting point | 146-150 °C | | Boiling point | 548.7±50.0 °C(Predicted) | | density | 1.235±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.67±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 12.0±1°, c = 1% in methanol | | BRN | 3629152 | | Major Application | peptide synthesis | | InChI | InChI=1S/C16H22N2O6/c1-16(2,3)24-14(21)17-9-12(13(19)20)18-15(22)23-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,18,22)(H,19,20)/t12-/m0/s1 | | InChIKey | WJKGPJRAGHSOLM-LBPRGKRZSA-N | | SMILES | C(O)(=O)[C@H](CNC(OC(C)(C)C)=O)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 16947-84-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | L-N-Cbz-3-N-Boc-Amino-alanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | L-N-Cbz-3-N-Boc-Amino-alanine Preparation Products And Raw materials |
|