|
|
| | 5-(Aminomethyl)-2-chloropyridine Basic information |
| | 5-(Aminomethyl)-2-chloropyridine Chemical Properties |
| Melting point | 28-34 °C | | Boiling point | 101-102°C 1mm | | density | 1.244±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil to Low-Melting Solid | | pka | 7.78±0.29(Predicted) | | color | Off-White to Light Brown | | Sensitive | Hygroscopic | | BRN | 8308740 | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H7ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H,3,8H2 | | InChIKey | XPARFBOWIYMLMY-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC=C1CN | | CAS DataBase Reference | 97004-04-1(CAS DataBase Reference) |
| Hazard Codes | T,C | | Risk Statements | 25-37/38-41-43-34 | | Safety Statements | 26-36/37/39-45-20 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 5-(Aminomethyl)-2-chloropyridine Usage And Synthesis |
| Chemical Properties | White to Off-white crystal | | Uses | 5-Aminomethyl-2-chloropyridine is a reagent that is used in the synthesis of macamides and analogs that have FAAH (fatty acid amide hydrolase) inhibitory activity. | | Synthesis | General procedure for the synthesis of 5-aminomethyl-2-chloropyridine from the compound (CAS:1080018-12-7) (Example 5): preparation of (2-chloropyridin-5-yl)methylamine (4). To 0.77 g (1.66 mmol) of 1,3,5-tris[(2-chloropyridin-5-yl)methyl]-1,3,5-perhydrotriazine (II-4) were sequentially added 0.40 g of methanol and 1.83 g of concentrated hydrochloric acid, and the resultant mixture was stirred for 6 hr. at 75 to 80° C. The reaction was carried out with the aid of a liquid chromatograph. After completion of the reaction, the reaction mixture was diluted with chloroform and adjusted to basicity by addition of 28% aqueous sodium hydroxide. The chloroform layer was separated and concentrated to give 0.68 g (yield: 95%) of the target product (2-chloropyridin-5-yl)methylamine (III-1). | | References | [1] Patent: EP2141149, 2010, A1. Location in patent: Page/Page column 17 [2] Patent: US2010/121054, 2010, A1. Location in patent: Page/Page column 9 |
| | 5-(Aminomethyl)-2-chloropyridine Preparation Products And Raw materials |
|