|
|
| | 2-chloro-5-cyanopyridine Basic information |
| | 2-chloro-5-cyanopyridine Chemical Properties |
| Melting point | 116-120 °C(lit.) | | Boiling point | 105-107°C 1mm | | density | 1.33±0.1 g/cm3(Predicted) | | Fp | 105-107°C/1mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Ethanol | | pka | -3.56±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | BRN | 113867 | | InChI | InChI=1S/C6H3ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H | | InChIKey | ORIQLMBUPMABDV-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC=C1C#N | | CAS DataBase Reference | 33252-28-7(CAS DataBase Reference) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/39-37 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-chloro-5-cyanopyridine Usage And Synthesis |
| Chemical Properties | Yellow to Brown Cryst | | Uses | 2-Chloro-5-cyanopyridine (cas# 33252-28-7) is a compound useful in organic synthesis. | | Uses | 6-Chloro-3-pyridinecarbonitrile (2-Chloro-5-cyanopyridine) may be used in the preparation of:
- (6-chloro-3-pyridyl)methylamine
- 2-(N-methyl-N-isopropylamino)-5-cyanopyridine
- S-(5-cyano-2-pyridyl)thiouronium chloride
| | General Description | 6-Chloro-3-pyridinecarbonitrile is a substituted pyridine. | | Synthesis | Taking 2-chloro-5-trichloromethylpyridine and ammonium chloride as raw materials, the weight ratio of 2-chloro-5-trichloromethylpyridine to ammonium chloride is 1:1.1 to 1:3, and under the catalyst's catalytic action, the reaction temperature is in the range of 100 to 250C, and the reaction time is in the range of 1 to 18 hours, to produce 2-chloro-5-cyanopyridine.
|
| | 2-chloro-5-cyanopyridine Preparation Products And Raw materials |
|