- D-Norleucine
-
-
2026-08-21
- CAS:327-56-0
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 50kg
- D-Norleucine
-
- $3.00
-
2019-07-06
- CAS:327-56-0
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 1000kg
|
| | D-Norleucine Basic information |
| | D-Norleucine Chemical Properties |
| Melting point | ≥300 °C | | alpha | [α]D20 -23.0~-25.0゜ (c=4, HCl) | | Boiling point | 234.0±23.0 °C(Predicted) | | density | 1.1720 (estimate) | | refractive index | -23 ° (C=4.5, 6mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.55±0.24(Predicted) | | form | powder to crystal | | color | White | | Water Solubility | 15.75g/L(19 ºC) | | Merck | 14,6706 | | BRN | 1721749 | | InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 | | InChIKey | LRQKBLKVPFOOQJ-RXMQYKEDSA-N | | SMILES | C(O)(=O)[C@@H](CCCC)N | | CAS DataBase Reference | 327-56-0(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29224999 |
| | D-Norleucine Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder or flakes | | Uses | D-Norleucine is used for the synthesis of Thailandepsin B, a bicyclic depsipeptide histone deacetylase inhibitor. | | Definition | ChEBI: D-norleucine is the D-enantiomer of 2-aminohexanoic acid. It is an enantiomer of a L-norleucine. It is a tautomer of a D-norleucine zwitterion. | | Purification Methods | Crystallise norleucine from water or aqueous MeOH. [Huffman & Ingersoll J Am Chem Soc 73 3366 1951, Beilstein 4 III 1386, 4 IV 2628.] |
| | D-Norleucine Preparation Products And Raw materials |
|