|
|
| | Adiphenine hydrochloride Basic information |
| Product Name: | Adiphenine hydrochloride | | Synonyms: | 2-(Diethylamino)ethyl a-phenylbenzeneacetate hydrochloride;Disodium (6E)-4-amino-3-(4-nitrophenyl)diazenyl-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonate;Oil Black S;Orient Water Black R 455;Spasnil;Spasmolytin;2,2-diphenylacetic acid 2-diethylaminoethyl ester hydrochloride;2-diethylaminoethyl 2,2-diphenylacetate hydrochloride | | CAS: | 50-42-0 | | MF: | C20H25NO2.ClH | | MW: | 347.88 | | EINECS: | 200-036-9 | | Product Categories: | ETHYOL | | Mol File: | 50-42-0.mol |  |
| | Adiphenine hydrochloride Chemical Properties |
| Melting point | 113-114° | | density | 1.0555 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Very Slightly) | | form | Solid | | color | White | | Merck | 14,161 | | InChI | InChI=1S/C20H25NO2.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H | | InChIKey | LKPINBXAWIMZCG-UHFFFAOYSA-N | | SMILES | C(C(=O)OCCN(CC)CC)(C1=CC=CC=C1)C1=CC=CC=C1.Cl | | CAS DataBase Reference | 50-42-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | AH2625000 | | HS Code | 2922.19.7000 | | Toxicity | LD50 i.p. in mice: 0.24 g/kg (Burtner, Cusic) |
| | Adiphenine hydrochloride Usage And Synthesis |
| Originator | Adiphenine
hydrochloride,Spectrum Chemicals and
Laboratory Products, Inc. | | Uses | Adiphenine hydrochloride is an anticholinergic. Adiphenine hydrochloride is used as an antispasmodic. | | Uses | radioprotectant | | Manufacturing Process | 10.6 parts of α,α-diphenylacetic acid are treated with thionyl chloride and the
diphenylacetylchloride thus produced is caused to react with 5.9 parts of
diethylaminoethanol at 120°C. The α,α-diphenylacetic acid, 2-
(diethylamino)ethanol ester hydrochloride thus produced is crystallized from
ethyl acetate; it melts at 113-114°C. | | Therapeutic Function | Anticholinergic, Spasmolytic, Smooth muscle relaxant | | in vivo | Adiphenine (i.p.) prevents the hindleg tonic-extensor component of maximal electroshock seizures (MES), with an ED50 of 62 mg/kg in mice[3]. |
| | Adiphenine hydrochloride Preparation Products And Raw materials |
|