|
|
| | 2-BROMO-4,6-DIMETHYLANILINE Basic information |
| Product Name: | 2-BROMO-4,6-DIMETHYLANILINE | | Synonyms: | 2-BROMO-4,6-DIMETHYLANILINE;6-BROMO-2,4-XYLIDINE;RARECHEM AQ BD 0012;BENZENAMINE,2-BROMO-4,6-DIMETHYL;2-Bromo-4,6-dimethyl-phenylamine;2-Amino-3,5-dimethyl-1-bromobenzene;2-Bromo-4,6-dimethylaniline, 98+%;6-Bromo-2,4-dimethylaniline | | CAS: | 41825-73-4 | | MF: | C8H10BrN | | MW: | 200.08 | | EINECS: | 609-959-5 | | Product Categories: | Amines;C8;Nitrogen Compounds;Anilines, Amides & Amines;Bromine Compounds | | Mol File: | 41825-73-4.mol |  |
| | 2-BROMO-4,6-DIMETHYLANILINE Chemical Properties |
| Melting point | 43-47 °C (lit.) | | Boiling point | 75-79°C 5mm | | density | 1.424 | | refractive index | 1.5748 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 2.82±0.10(Predicted) | | color | Amber to Dark green to Black | | Water Solubility | Insoluble in water. | | BRN | 3046484 | | InChI | InChI=1S/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 | | InChIKey | YOSJCQJJIHEUKA-UHFFFAOYSA-N | | SMILES | C1(N)=C(C)C=C(C)C=C1Br | | CAS DataBase Reference | 41825-73-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-Bromo-4,6-dimethylaniline (41825-73-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-BROMO-4,6-DIMETHYLANILINE Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-Bromo-4,6-dimethylaniline can react with 3-chloro-3-methyl-but-1-yne to produce 2-bromo-N-(1',1'-dimethylprop-2'-ynyl)-4,6-dimethylaniline. This reaction will need reagent Et3N, catalyst CuCl, and the menstruum dioxane. |
| | 2-BROMO-4,6-DIMETHYLANILINE Preparation Products And Raw materials |
|