2-AMINO-3-BROMO-5-METHYLBENZOIC ACID manufacturers
|
| | 2-AMINO-3-BROMO-5-METHYLBENZOIC ACID Basic information |
| | 2-AMINO-3-BROMO-5-METHYLBENZOIC ACID Chemical Properties |
| Melting point | 204-208 °C (lit.) | | Boiling point | 350.2±42.0 °C(Predicted) | | density | 1.682±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystalline | | pka | 4.62±0.10(Predicted) | | color | White to Light yellow | | BRN | 3540992 | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H8BrNO2/c1-4-2-5(8(11)12)7(10)6(9)3-4/h2-3H,10H2,1H3,(H,11,12) | | InChIKey | LCMZECCEEOQWLQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C)=CC(Br)=C1N | | CAS DataBase Reference | 13091-43-5(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-43 | | Safety Statements | 37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 2-AMINO-3-BROMO-5-METHYLBENZOIC ACID Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-AMINO-3-BROMO-5-METHYLBENZOIC ACID Preparation Products And Raw materials |
|