|
|
| | 4-Chloro-3-fluorobenzonitrile Basic information |
| | 4-Chloro-3-fluorobenzonitrile Chemical Properties |
| Melting point | 79-81°C | | Boiling point | 214.0±20.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H | | InChIKey | GWZQVECNESCSKR-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Cl)C(F)=C1 | | CAS DataBase Reference | 110888-15-8(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-Chloro-3-fluorobenzonitrile Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | 4-Chloro-3-fluorobenzonitrile is a key intermediate in the synthesis of 3,4-Difluorobenzonitrile and is used to prepare other fluorobenzonitriles. | | Toxics Screening Level | The current ITSL isbeing set at the default value of 0.1 μg/m3 with annual averaging. |
| | 4-Chloro-3-fluorobenzonitrile Preparation Products And Raw materials |
|