|
|
| | Boc-L-Tyr(all)-OH Basic information |
| Product Name: | Boc-L-Tyr(all)-OH | | Synonyms: | N-ALPHA-TERT-BUTYLOXYCARBONYL-O-ALLYL-L-TYROSINE;N-ALPHA-T-BUTYLOXYCARBONYL-O-ALLYL-L-TYROSINE;(S)-3-(4-(allyloxy)phenyl)-2-(tert-butoxycarbonylamino)propanoic acid;BOC-TYR(ALL)-OH;BOC-TYR(ALLYL)-OH;BOC-TYR(AL)-OH;BOC-L-TYROSINE ALLYL ESTER;BOC-O-ALLYL-L-TYROSINE | | CAS: | 127132-38-1 | | MF: | C17H23NO5 | | MW: | 321.37 | | EINECS: | | | Product Categories: | | | Mol File: | 127132-38-1.mol |  |
| | Boc-L-Tyr(all)-OH Chemical Properties |
| Boiling point | 490.4±45.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.99±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | BRN | 3624582 | | Major Application | peptide synthesis | | InChI | 1S/C17H23NO5/c1-5-10-22-13-8-6-12(7-9-13)11-14(15(19)20)18-16(21)23-17(2,3)4/h5-9,14H,1,10-11H2,2-4H3,(H,18,21)(H,19,20)/t14-/m0/s1 | | InChIKey | YIRRNENSHUFZBH-AWEZNQCLSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OCC=C)cc1)C(O)=O |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-Tyr(all)-OH Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Due to gem-dimethyl substituent effect, Boc-Tyr(Allyl)-OH is found to be resistant to Claisen rearrangement in water. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-Tyr(all)-OH Preparation Products And Raw materials |
|