|
|
| | PHELLODENDRINE CHLORIDE Basic information |
| Product Name: | PHELLODENDRINE CHLORIDE | | Synonyms: | Phellodendrine hydrochloride;(13aS)-2,11-dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolinium chloride;Phellodendrine chloride, 98%, from Phellodendron amurense Rupr.;6H-Dibenzo[a,g]quinolizinium,5,8,13,13a-tetrahydro-2,11-dihydroxy-3,10-dimethoxy-7-methyl-, chloride (1:1),(7S,13aS)-;Phellodendrine HCl;(7S,13aS)-2,11-Dihydroxy-3,10-dimethoxy-7-methyl-5,6,7,8,13,13a-hexahydroisoquinolino[3,2-a]isoquinolin-7-ium chloride;(13aS)-2,11-dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tet...;Phellodendrine chloride | | CAS: | 104112-82-5 | | MF: | C20H24NO4.Cl | | MW: | 377.86 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 104112-82-5.mol |  |
| | PHELLODENDRINE CHLORIDE Chemical Properties |
| Melting point | 249-251℃ (methanol ) | | solubility | Soluble in ethanol and methan | | form | powder | | color | White | | Stability: | Hygroscopic | | InChI | InChI=1/C20H23NO4.ClH/c1-21-5-4-12-8-19(24-2)18(23)10-15(12)16(21)6-13-7-17(22)20(25-3)9-14(13)11-21;/h7-10,16H,4-6,11H2,1-3H3,(H-,22,23);1H/t16-,21;/s3 | | InChIKey | DGLDSNPMIYUWGN-MMZIOARKNA-N | | SMILES | [C@@]12([H])CC3=C(C=C(OC)C(O)=C3)C[N+]1(C)CCC1C=C(OC)C(O)=CC2=1.[Cl-] |&1:0,r| |
| Safety Statements | 24/25 | | HS Code | 29389090 |
| | PHELLODENDRINE CHLORIDE Usage And Synthesis |
| Chemical Properties | Sichuan Cork is derived from the dried bark of the Rutaceae plant Phellodendronchinese Schneid. | | Uses | Phellodendrine Chloride is an alkaloid isolated from the Phellodrndron amurensis, which shows activity as an immunosuppressor agains tthe cellular immune response. |
| | PHELLODENDRINE CHLORIDE Preparation Products And Raw materials |
|