| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- BOC-D-2-Methylphe
-
- $20.00
-
2019-07-06
- CAS:80102-29-0
- Min. Order: 10KG
- Purity: 98%
- Supply Ability: 100kg
|
| | BOC-D-2-Methylphe Basic information |
| | BOC-D-2-Methylphe Chemical Properties |
| Melting point | 116°C | | Boiling point | 442.5±40.0 °C(Predicted) | | alpha | 16 º (c=1,MeOH) | | density | 1.140±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.92±0.11(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-10-7-5-6-8-11(10)9-12(13(17)18)16-14(19)20-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m1/s1 | | InChIKey | PCGOCPOJLMLJAR-GFCCVEGCSA-N | | SMILES | Cc1ccccc1C[C@@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 80102-29-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | BOC-D-2-Methylphe Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-2-Methylphe Preparation Products And Raw materials |
|