|
|
| | Boc-2-Methyl-D-beta-phenylalanine Basic information |
| Product Name: | Boc-2-Methyl-D-beta-phenylalanine | | Synonyms: | (3S)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;Boc-S-2-Me-PHA;3-(2-methylphenyl)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]propanoic acid;(3S)-3-[(TERT-BUTOXY)CARBONYLAMINO]-3-(2-METHYLPHENYL)PROPANOIC ACID;(Tert-Butoxy)Carbonyl (S)-3-Amino-3-(2-methyl-phenyl)propionic acid;N-Boc-L-3-Amino-3-(2-methylphenyl)propanoic acid;(s)-boc-2-methyl-β-phe-oh;Boc-b-Phe(2-Me)-OH | | CAS: | 499995-74-3 | | MF: | C15H21NO4 | | MW: | 279.33 | | EINECS: | | | Product Categories: | | | Mol File: | 499995-74-3.mol |  |
| | Boc-2-Methyl-D-beta-phenylalanine Chemical Properties |
| Melting point | 158-160°C | | Boiling point | 439.4±40.0 °C(Predicted) | | density | 1.138±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.36±0.10(Predicted) | | form | powder | | color | white | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-10-7-5-6-8-11(10)12(9-13(17)18)16-14(19)20-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | WWDMSBGBNGEQDH-LBPRGKRZSA-N | | SMILES | Cc1ccccc1[C@H](CC(O)=O)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-2-Methyl-D-beta-phenylalanine Usage And Synthesis |
| | Boc-2-Methyl-D-beta-phenylalanine Preparation Products And Raw materials |
|